Desmopressin is a synthetic analogue of the hormone vasopressin, used to treat conditions such as central diabetes insipidus, nocturnal enuresis (bed-wetting), and certain bleeding disorders like hemophilia A and von Willebrand disease. It works by reducing urine production and increasing water reabsorption in the kidneys.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Desmopressin (Acetate), Desmospray, Vasopressin, 1-(3-mercaptopropanoic acid)-8-D-arginine-, monoacetate (salt) |
|---|---|
| IUPAC Name | acetic acid;N-[1-[(2-amino-2-oxoethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-benzyl-16-[(4-hydroxyphenyl)methyl]-6, 9, 12, 15, 18-pentaoxo-1, 2-dithia-5, 8, 11, 14, 17-pentazacycloicosane-4-carbonyl]pyrrolidine-2-carboxamide |
| CAS | 62288-83-9 |
| Molecular Weight | 1129.3 |
| Molecular Formula | C48H68N14O14S2 |
| SMILES | CC(=O)O.C1CC(N(C1)C(=O)C2CSSCCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2)CC(=O)N)CCC(=O)N)CC3=CC=CC=C3)CC4=CC=C(C=C4)O)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)N |