Hordenine is a phenylethylamine alkaloid naturally occurring in plants such as barley (Hordeum species), cacti, and fungi. It is derived from tyrosine and acts as an allelopathic compound, inhibiting root growth in plants. In humans, hordenine inhibits melanogenesis by suppressing tyrosinase activity and melanin pigmentation pathways.
Hordenine has been studied for its effects on blood pressure, cardiovascular, respiratory, and nervous systems in animals, but its oral bioavailability and effects in humans remain poorly understood.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Hordenine sulfate, Anhaline sulfate, 4-(2-(Dimethylamino)ethyl)phenol sulfate |
|---|---|
| IUPAC Name | 4-[2-(dimethylamino)ethyl]phenol;sulfuric acid |
| CAS | 62493-39-4 |
| Molecular Weight | 263.31 |
| Molecular Formula | C10H17NO5S |
| SMILES | CN(C)CCC1=CC=C(C=C1)O.OS(=O)(=O)O |