Taltirelin, marketed under the tradename Ceredist, is a thyrotropin-releasing hormone (TRH) analog that mimics the physiological actions of TRH but with a longer half-life and duration of effects.
It exhibits nootropic, neuroprotective, and analgesic properties. Taltirelin is primarily researched for treating spinocerebellar ataxia and has shown potential in addressing other neurodegenerative disorders, such as spinal muscular atrophy.
It is known for its ability to cross the blood-brain barrier and its lack of tolerance development with prolonged use.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | TA 0910, Ceredist |
|---|---|
| IUPAC Name | (4S)-N-[(2S)-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-1-methyl-2, 6-dioxo-1, 3-diazinane-4-carboxamide |
| CAS | 103300-74-9 201677-75-0 |
| Molecular Weight | 405.4 |
| Molecular Formula | C17H23N7O5 |
| SMILES | CN1C(=O)C[C@H](NC1=O)C(=O)N[C@@H](CC2=CN=CN2)C(=O)N3CCC[C@H]3C(=O)N |