| Other Names | 3, 4, 5-Trifluorophenylboronic acid, 143418-49-9, (3, 4, 5-trifluorophenyl)boronic Acid, 3, 4, 5-Trifluorobenzeneboronic Acid, 3, 4, 5-Trifluorophenyl boronic acid, MFCD02093069, (3, 4, 5-Trifluorophenyl)boronic Acid (contains varying amounts of Anhydride), Boronic acid, (3, 4, 5-trifluorophenyl)-, BORONIC ACID, B-(3, 4, 5-TRIFLUOROPHENYL)-, EC 604-355-8, AKOS BRN-0138, SCHEMBL177479, DTXSID60370438, 3, 4, 5-Trifluorphenylboronic acid, BCP22735, CS-D1006, (3, 4, 5-trifluorophenyl)boronicAcid, 3, 4, 5-trifluoro-phenylboronic acid, 3, 4, 5-trifluorobenzene boronic acid, AKOS004116551, AB10760, AC-5392, BCP9000265, FT70125, GS-6729, (3, 4, 5-trifluoro-phenyl)-boronic acid, NCGC00249510-01, HY-32892, SY007885, 3, 4, 5-TRIFLUOROPHENYLBORONIC AICD, DB-028244, NS00005502, T2300, EN300-53326, 3 pound not4 pound not5-Trifluorophenyl boronic acid, Z798912500, 3, 4, 5-Trifluorophenylboronic acid pound contains varying amounts of Anhydride pound(c), 604-355-8 |
|---|---|
| IUPAC Name | (3, 4, 5-trifluorophenyl)boronic acid |
| CAS | 225937-10-0 |
| Molecular Weight | 175.9 |
| Molecular Formula | C6H4BF3O2 |
| SMILES | B(C1=CC(=C(C(=C1)F)F)F)(O)O |




![1H-Pyrrolo[2,3-b]pyridine, 3-iodo-4-nitro- - (1000340-40-8)](https://eontrading.uk/wp-content/uploads/2025/04/1000340-40-8.png)

