4-Methylaminorex is a stimulant drug of the 2-amino-5-aryloxazoline group, first synthesized in 1960 by McNeil Laboratories. 4-Methylaminorex has been associated with abuse potential, neurotoxicity, and pulmonary hypertension in some cases.
The drug has been studied for its pharmacological properties, including its potential as a sympathomimetic and anorectic agent, but its safety profile remains less established compared to other clinical psychostimulants.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| IUPAC Name | 2-Amino-4-methyl-5-phenyl-2-oxazoline |
|---|---|
| CAS | 3568-94-3 |
| Molecular Weight | 176.21 |
| Molecular Formula | C10H12N2O |
| SMILES | CC1C(OC(=N1)N)C2=CC=CC=C2 |