Fluorenone is utilized as a biochemical reagent in life science research and organic synthesis intermediates.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | 9H-Fluoren-9-one, Fluoren-9-one, FLUORENONE |
|---|---|
| IUPAC Name | fluoren-9-one |
| CAS | 486-25-9 |
| Molecular Weight | 180.2 |
| Molecular Formula | C13H8O |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2=O |