Allopregnanolone is a naturally occurring neurosteroid synthesized from progesterone in the body. It acts as a positive allosteric modulator of the GABA receptor, enhancing inhibitory neurotransmission.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Brexanolone, Allotetrahydroprogesterone, Allopregnan-3alpha-ol-20-one |
|---|---|
| IUPAC Name | 1-[(3R, 5S, 8R, 9S, 10S, 13S, 14S, 17S)-3-hydroxy-10, 13-dimethyl-2, 3, 4, 5, 6, 7, 8, 9, 11, 12, 14, 15, 16, 17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| CAS | 516-54-1 |
| Molecular Weight | 318.5 |
| Molecular Formula | C21H34O2 |
| SMILES | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CC[C@H](C4)O)C)C |