| Other Names | CITRONELLAL, 106-23-0, 3, 7-Dimethyloct-6-enal, 3, 7-Dimethyl-6-octenal, Rhodinal, 2, 3-Dihydrocitral, 6-Octenal, 3, 7-dimethyl-, (+/-)-Citronellal, Citronellel, beta-Citronellal, Citronella, 3, 7-Dimethyl-6-octen-1-al, D-Rhodinal, CITRONELLOL, (D), Citronella (natural), FEMA No. 2307, .beta.-Citronellal, NSC 46106, HSDB 594, CHEBI:47856, UNII-QB99VZZ7GZ, QB99VZZ7GZ, EINECS 203-376-6, 3, 7-dimethyloct-6-en-1-al, CCRIS 8421, DTXSID3041790, AI3-00203, (+/-)-3, 7-Dimethyl-6-octenal, MFCD00038090, NSC-46106, 3, 7-dimethyl-oct-6-enal, ( inverted exclamation markA)-Citronellal, DTXCID1021790, Citronella oil, Chinese 85/35, EC 203-376-6, NSC46106, 3, 7-dimethyl-, cymbopogon winterianus, Citronellal Extra Rhodinal, rac-Citronellal (>90%), Rhodinal (VAN), 3, 7-Dimethyloct-6-enal 6-Octenal, essential oil obtained from the herbs of the plant, citric, natural isolate, beta -Citronellal, racemic citronellal, (RS)-citronellal, (+/-) citronellal, Citronellal (Standard), 6-Octenal, 7-dimethyl-, CITRONELLAL [MI], CITRONELLAL [FCC], CITRONELLAL [FHFI], CITRONELLAL [HSDB], Epitope ID:112868, 3, 7-dimethyl- Citronellal, SCHEMBL29275, CHEMBL447944, GTPL6300, FEMA 2307, HY-N7126R, HY-N7126, Tox21_301195, c1026, s5585, AKOS000121405, (+/-)-Citronellal, >=85%, FG, CCG-266248, CS-W010931, FC33220, (+/-)-Citronellal, analytical standard, NCGC00248328-01, NCGC00255093-01, AS-54400, CAS-106-23-0, (+/-)-Citronellal, >=95.0% (GC), 2, 3-Dihydrocitral 3, 7-Dimethyl-6-octenal, DB-040680, DB-072650, C3648, NS00077383, EN300-21458, C17384, P50009, (+/-)-Citronellal, natural, >=85%, FCC, FG, Q61651085, Z104497952, 2, 3-Dihydrocitral 3, 7-Dimethyl-6-octenal 3, 7-Dimethyloct-6-enal 6-Octenal, InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5, 8, 10H, 4, 6-7H2, 1-3H, 203-376-6 |
|---|---|
| IUPAC Name | 3, 7-dimethyloct-6-enal |
| CAS | 2385-77-5 |
| Molecular Weight | 154.25 |
| Molecular Formula | C10H18O |
| SMILES | CC(CCC=C(C)C)CC=O |


![1H-Pyrrolo[2,3-b]pyridine, 3-iodo-4-nitro- - (1000340-40-8)](https://eontrading.uk/wp-content/uploads/2025/04/1000340-40-8.png)



