4,6-Dinitro-o-cresol (DNOC) is a yellow crystalline solid with the chemical formula C7H6N2O5. It is slightly soluble in water and was historically used as an insecticide, herbicide, and fungicide. DNOC is an uncoupler of oxidative phosphorylation, disrupting ATP production and leading to increased heat production and body temperature. This mechanism of action makes it extremely toxic to humans and animals, with symptoms of exposure including profuse sweating, increased heart and respiratory rates, thirst, fatigue, headache, and appetite loss.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | 4, 6-DINITRO-O-CRESOL, DNOC, Antinonnin |
|---|---|
| IUPAC Name | 2-methyl-4, 6-dinitrophenol |
| CAS | 534-52-1 |
| Molecular Weight | 198.13 |
| Molecular Formula | C7H6N2O5 |
| SMILES | CC1=CC(=CC(=C1O)[N+](=O)[O-])[N+](=O)[O-] |