Domperidone is a dopamine antagonist primarily used to treat nausea and vomiting and certain gastrointestinal issues like gastroparesis.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Motilium |
|---|---|
| IUPAC Name | 6-chloro-3-[1-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| CAS | 57808-66-9 |
| Molecular Weight | 425.9 |
| Molecular Formula | C22H24ClN5O2 |
| SMILES | C1CN(CCC1N2C3=C(C=C(C=C3)Cl)NC2=O)CCCN4C5=CC=CC=C5NC4=O |