Indatraline hydrochloride is a potent antidepressant and non-selective monoamine transporter inhibitor that effectively blocks the reuptake of dopamine, norepinephrine, and serotonin.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Indatralinum |
|---|---|
| IUPAC Name | (1R, 3S)-3-(3, 4-dichlorophenyl)-N-methyl-2, 3-dihydro-1H-inden-1-amine |
| CAS | 86939-10-8 |
| Molecular Weight | 292.2 |
| Molecular Formula | C16H15Cl2N |
| SMILES | CN[C@@H]1C[C@H](C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl |