Melatonin is a natural hormone produced by the pineal gland in the brain, primarily in response to darkness, playing a crucial role in regulating the sleep-wake cycle, also known as the circadian rhythm, in humans and other vertebrates. Its discovery in 1958 by Aaron B. Lerner and colleagues stemmed from the isolation of a substance from the pineal gland of cows that could induce skin lightening in frogs. Beyond sleep regulation, melatonin influences blood pressure, seasonal rhythms, and acts as a potent antioxidant, protecting cells from oxidative stress.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Melatonine, N-Acetyl-5-methoxytryptamine, Circadin |
|---|---|
| IUPAC Name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| CAS | 73-31-4 |
| Molecular Weight | 232.28 |
| Molecular Formula | C13H16N2O2 |
| SMILES | CC(=O)NCCC1=CNC2=C1C=C(C=C2)OC |