S-18986 is a positive allosteric modulator of AMPA-type glutamate receptors, known for its cognitive-enhancing properties. This compound has demonstrated significant potential in improving memory and cognitive functions, particularly in the context of aging and neurodegenerative diseases. S-18986 increases the induction and maintenance of long-term potentiation (LTP) in the hippocampus, a key mechanism underlying learning and memory. Additionally, it enhances the expression of brain-derived neurotrophic factor (BDNF), which plays a crucial role in neuronal survival and growth.
In animal studies, S-18986 has shown robust memory-enhancing effects, particularly in middle-aged rodents compared to aged ones. It exhibits antiamnesic properties in spatial memory tasks and improves performance in various behavioral models, including procedural, spatial, episodic, working, and relational/declarative memory. The compound’s ability to activate the release of noradrenaline and acetylcholine in the rat hippocampus further underscores its potential as a therapeutic agent for cognitive disorders.
S-18986’s pharmacological profile suggests it could be a valuable tool in the treatment of cognitive deficits associated with early cerebral aging and neurological diseases such as Alzheimer’s. Its selectivity and brain penetrance make it a promising candidate for clinical development. However, further research is needed to fully understand its mechanisms of action and to validate its efficacy in human subjects.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | S 18986, S18986 |
|---|---|
| IUPAC Name | (3aS)-2, 3, 3a, 4-tetrahydro-1H-pyrrolo[2, 1-c][1, 2, 4]benzothiadiazine 5, 5-dioxide |
| CAS | 175340-20-2 |
| Molecular Weight | 224.28 |
| Molecular Formula | C10H12N2O2S |
| SMILES | C1C[C@@H]2NS(=O)(=O)C3=CC=CC=C3N2C1 |