| Other Names | 68921-72-2, EINECS 265-557-6, DTXSID0071837, Octyl di(diethanolamine)phosphate, EINECS 261-869-1, EINECS 267-480-3, Octyl dihydrogen phosphate, compound with 2, 2'-iminodiethanol (1:1), Octyl dihydrogen phosphate, compound with 2, 2'-iminodiethanol (1:2), 65151-84-0, NS00087545, Phosphated octyl alcohol, diethanolamine salt, Octyl phosphate (1:1), diethanolamine salt (1:2), Phosphoric acid, monoctyl ester, diethanolmine salt, Phosphoric acid, monoctyl ester, diethanolomine salt, Octyl dihydrogen phosphate, compound with 2, 2'-iminodiethanol |
|---|---|
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol octyl dihydrogen phosphate |
| CAS | 723286-80-4 |
| Molecular Weight | 315.34 |
| Molecular Formula | C12H30NO6P |
| SMILES | CCCCCCCCOP(=O)(O)O.C(CO)NCCO |

![tert-Butyl 3-bromo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-7(8H)-carboxylate - (723286-80-4)](https://eontrading.uk/wp-content/uploads/2025/04/723286-80-4.png)


![1H-Pyrrolo[2,3-b]pyridine, 3-bromo-4-chloro- - (1000340-39-5)](https://eontrading.uk/wp-content/uploads/2025/04/1000340-39-5.png)

