Anastrozole is a nonsteroidal aromatase inhibitor used to treat hormone receptor-positive breast cancer in postmenopausal women. It works by reducing estrogen production in the body, which can slow or stop the growth of certain types of breast cancer that require estrogen to grow.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | anastrozole, Arimidex, anastrazole, Anastrozol |
|---|---|
| IUPAC Name | 2-[3-(2-cyanopropan-2-yl)-5-(1, 2, 4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile |
| CAS | 120511-73-1 |
| Molecular Weight | 293.4 |
| Molecular Formula | C17H19N5 |
| SMILES | CC(C)(C#N)C1=CC(=CC(=C1)CN2C=NC=N2)C(C)(C)C#N |