Gonadorelin is a synthetic form of gonadotropin-releasing hormone (GnRH), a decapeptide that plays a critical role in regulating reproductive function. It is used in both human and veterinary medicine to stimulate the release of luteinizing hormone (LH) and follicle-stimulating hormone (FSH) from the pituitary gland.
In humans, gonadorelin is primarily employed as a diagnostic tool to evaluate pituitary function and in the treatment of conditions such as hypothalamic amenorrhea, hypogonadotropic hypogonadism, delayed puberty, and infertility. Its mechanism of action involves binding to GnRH receptors on pituitary gonadotropes, triggering the release of LH and FSH, which in turn stimulate gonadal steroidogenesis and gametogenesis.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | LHRH diacetate, UNII-7AT6GVO7OA, LH-RH, human |
|---|---|
| IUPAC Name | acetic acid;(2S)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[2-[[(2S)-1-[[(2S)-1-[(2S)-2-[(2-amino-2-oxoethyl)carbamoyl]pyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-5-oxopyrrolidine-2-carboxamide |
| CAS | 71447-49-9 |
| Molecular Weight | 1302.4 |
| Molecular Formula | C59H83N17O17 |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N)NC(=O)CNC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)[C@H](CC5=CN=CN5)NC(=O)[C@@H]6CCC(=O)N6.CC(=O)O.CC(=O)O |