DIPPA hydrochloride is a selective and high-affinity κ-opioid receptor antagonist. This compound is characterized by its irreversible and long-lasting binding to the κ-opioid receptor, making it a valuable tool for research in anxiety and depression.
DIPPA hydrochloride has been studied for its potential anti-depressant effects, with research demonstrating its ability to influence feeding behavior and immobility in animal models.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | DIPPA hydrochloride, DIPPA (hydrochloride), (S)-DIPPA hydrochloride |
|---|---|
| IUPAC Name | 2-(3, 4-dichlorophenyl)-N-[(1S)-1-(3-isothiocyanatophenyl)-2-pyrrolidin-1-ylethyl]-N-methylacetamide;hydrochloride |
| CAS | 155512-52-0 |
| Molecular Weight | 484.9 |
| Molecular Formula | C22H24Cl3N3OS |
| SMILES | CN([C@H](CN1CCCC1)C2=CC(=CC=C2)N=C=S)C(=O)CC3=CC(=C(C=C3)Cl)Cl.Cl |