GW501516 is a PPARδ receptor agonist developed in the 1990s through a collaboration between Ligand Pharmaceuticals and GlaxoSmithKline. Initially investigated for its potential in treating metabolic and cardiovascular diseases, the drug was discontinued in 2007 after animal studies revealed it caused rapid cancer development in multiple organs.
Its mechanism of action involves activating PPARδ, which enhances fatty acid metabolism and energy expenditure, but it also poses significant cancer risks at higher doses.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Endurobol, GW 501516, GW-501516 |
|---|---|
| IUPAC Name | 2-[2-methyl-4-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1, 3-thiazol-5-yl]methylsulfanyl]phenoxy]acetic acid |
| CAS | 317318-70-0 |
| Molecular Weight | 453.5 |
| Molecular Formula | C21H18F3NO3S2 |
| SMILES | CC1=C(C=CC(=C1)SCC2=C(N=C(S2)C3=CC=C(C=C3)C(F)(F)F)C)OCC(=O)O |


