Kisspeptin is a protein encoded by the KISS1 gene, crucial for reproductive hormone secretion and fertility. Initially discovered in 1996 in Hershey, Pennsylvania, it was named after the city’s famous chocolate ‘Kisses’. Kisspeptin is primarily produced in the hypothalamus and plays a pivotal role in regulating the release of gonadotropin-releasing hormone (GnRH), which in turn stimulates the secretion of luteinizing hormone (LH) and follicle-stimulating hormone (FSH) from the pituitary gland. These hormones are essential for sexual maturation and reproduction.
Kisspeptin also has a non-hormonal role as a metastasis suppressor, originally termed ‘metastin’ due to its ability to inhibit the spread of cancer cells. It acts through the G-protein coupled receptor GPR54, influencing various physiological processes, including puberty onset, tumor suppression, and kidney function.
Kisspeptin is also involved in tumor suppression, with studies showing that its expression is associated with non-metastatic tumor cells, suggesting its role in preventing cancer spread. During pregnancy, kisspeptin levels rise dramatically, indicating its importance in placental function and potential as a predictor of pregnancy complications.
Additionally, kisspeptin has been investigated for its role in treating conditions like hypothalamic amenorrhea and as a potential fertility treatment. Research indicates that kisspeptin injections can induce ovulation without the risk of ovarian hyperstimulation syndrome, making it a promising option for assisted reproduction.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Kisspeptin-10, Metastin (45-54), Kisspeptin-10 (human), KP-10 |
|---|---|
| IUPAC Name | (2S)-N-[(2S)-1-[[(2S)-4-amino-1-[[(2S)-1-[[(2S)-1-[[2-[[(2S)-1-[[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1, 4-dioxobutan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]butanediamide |
| CAS | 374675-21-5 |
| Molecular Weight | 1302.4 |
| Molecular Formula | C63H83N17O14 |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N)NC(=O)CNC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CO)NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](CC5=CC=C(C=C5)O)N |