LGD-2226 is a selective androgen receptor modulator (SARM) currently under investigation for its potential in treating muscle wasting and osteoporosis.
In preclinical studies, LGD-2226 has shown efficacy in enhancing bone strength and muscle mass while minimizing prostate enlargement. It has also demonstrated positive effects on sexual function in rodent models. These findings highlight the potential of LGD-2226 as a therapeutic agent for conditions such as osteoporosis, frailty, and sexual dysfunction, offering the benefits of androgens without their associated side effects.
LGD-2226’s tissue-selective activity and oral bioavailability make it a promising candidate for further research and development.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | LGD-2226, RI376RM5MT |
|---|---|
| IUPAC Name | 6-[bis(2, 2, 2-trifluoroethyl)amino]-4-(trifluoromethyl)-1H-quinolin-2-one |
| CAS | 328947-93-9 |
| Molecular Weight | 392.22 |
| Molecular Formula | C14H9F9N2O |
| SMILES | C1=CC2=C(C=C1N(CC(F)(F)F)CC(F)(F)F)C(=CC(=O)N2)C(F)(F)F |