Modafiendz is a wakefulness-promoting agent related to modafinil. It is a bis-fluoro and N-methylated derivative of modafinil and the N-methyl analogue of flmodafinil (CRL-40,940) and fladrafinil (CRL-40,941).
Modafiendz acts as a selective dopamine reuptake inhibitor, contributing to its wakefulness-promoting effects. Its long-term effects and safety profile in healthy individuals remain unknown.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | N-Methyl-4, 4-difluoro modafinil, Dehydroxyfluorafinil, Methyldifluoromodafinil |
|---|---|
| IUPAC Name | 2-[bis(4-fluorophenyl)methylsulfinyl]-N-methylacetamide |
| CAS | 1613222-54-0 |
| Molecular Weight | 323.4 |
| Molecular Formula | C16H15F2NO2S |
| SMILES | CNC(=O)CS(=O)C(C1=CC=C(C=C1)F)C2=CC=C(C=C2)F |