Nevadistinel, also known as NYX-458 or NYX-3054, is a small molecule drug. It is a positive allosteric modulator of the N-methyl-D-aspartate (NMDA) receptor. This compound is being investigated for its potential to inhibit cognitive impairment associated with neurodegenerative diseases such as mild cognitive impairment, mild Alzheimer’s disease, Parkinson’s disease, and Lewy body disease.
Nevadistinel’s chemical structure is characterized by a spiro-lactam core, and it has a unique mechanism of action that distinguishes it from other NMDA receptor modulators. The compound is currently in clinical trials, with a maximum phase of II across all indications. It is being studied for its efficacy and safety in treating cognitive deficits related to various neurological conditions.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | NYX-458, NYX-3054 |
|---|---|
| IUPAC Name | (4S)-2-[(4-methoxyphenyl)methyl]-2, 7-diazaspiro[3.5]nonane-3, 6-dione |
| CAS | 2181816-92-0 |
| Molecular Weight | 274.31 |
| Molecular Formula | C15H18N2O3 |
| SMILES | COC1=CC=C(C=C1)CN2C[C@]3(C2=O)CCNC(=O)C3 |