PRX-14040 is a selective dopamine reuptake inhibitor developed by Prexa Pharmaceuticals. It exhibits 28-fold selectivity for the dopamine transporter over the norepinephrine transporter.
The molecule has been shown to reverse motivational deficits induced by the dopamine-depleting agent tetrabenazine in animal studies. PRX-14040 is part of the class of dopamine reuptake inhibitors and is categorized as an experimental drug with potential pro-motivational effects.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| IUPAC Name | 1-[1-(3, 4-dichlorophenyl)cyclobutyl]-2-(2-oxa-5-azoniabicyclo[2.2.1]heptan-5-yl)ethanol;chloride |
|---|---|
| Molecular Weight | 378.7 |
| Molecular Formula | C17H22Cl3NO2 |
| SMILES | C1CC(C1)(C2=CC(=C(C=C2)Cl)Cl)C(C[NH+]3CC4CC3CO4)O.[Cl-] |