S-4, also known as Andarine, is a selective androgen receptor modulator (SARM) under investigation for its potential in treating conditions like muscle wasting, osteoporosis, and benign prostatic hypertrophy. This orally active compound acts as a partial agonist for androgen receptors, exhibiting less potent anabolic and androgenic effects compared to other SARMs. In animal models of benign prostatic hypertrophy, Andarine has demonstrated the ability to reduce prostate weight with efficacy similar to finasteride, without causing muscle mass reduction or anti-androgenic side effects.
Andarine’s potential therapeutic applications are supported by its ability to act as a tissue-selective agonist, showing significant effects in specific tissues while minimizing impact on others. This selectivity is crucial for reducing unwanted side effects commonly associated with traditional androgen therapies. Researchers and pharmaceutical developers are particularly interested in Andarine’s potential to provide the benefits of androgen therapy without the associated risks, making it a promising candidate for further study in various clinical applications.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Andarine, GTX-007, S-4 cpd |
|---|---|
| IUPAC Name | (2S)-3-(4-acetamidophenoxy)-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| CAS | 401900-40-1 |
| Molecular Weight | 441.4 |
| Molecular Formula | C19H18F3N3O6 |
| SMILES | CC(=O)NC1=CC=C(C=C1)OC[C@@](C)(C(=O)NC2=CC(=C(C=C2)[N+](=O)[O-])C(F)(F)F)O |