SCH-23390 hydrochloride, also known as R-(+)-SCH-23390 hydrochloride, is a potent and selective dopamine D1-like receptor antagonist. Additionally, it acts as a potent and high-efficacy agonist at human 5-HT2C receptors, and it binds with high affinity to 5-HT1 and 5-HT2 receptors.
This compound is primarily used in research settings to study the role of dopamine and serotonin receptors in various neurological processes. It has been shown to reverse the inhibitory effects of certain compounds on neuroinflammatory pathways and is extensively used as a tool in the topographical determination of brain D1 receptors in rodents, nonhuman primates, and humans.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | R(+)-SCH-23390 hydrochloride, (R)-(+)-Sch 23390 Hydrochloride |
|---|---|
| IUPAC Name | (5R)-8-chloro-3-methyl-5-phenyl-1, 2, 4, 5-tetrahydro-3-benzazepin-7-ol;hydrochloride |
| CAS | 125941-87-9 |
| Molecular Weight | 324.2 |
| Molecular Formula | C17H19Cl2NO |
| SMILES | CN1CCC2=CC(=C(C=C2[C@H](C1)C3=CC=CC=C3)O)Cl.Cl |