Sepiapterin, also known as L-Sepiapterin, is a naturally occurring pteridine derivative and a precursor to tetrahydrobiopterin (BH4), an essential cofactor in various metabolic processes. Sepiapterin plays a crucial role in the biosynthesis of neurotransmitters such as dopamine and serotonin. It is being investigated for its potential therapeutic applications in treating conditions related to BH4 deficiency, including phenylketonuria and tetrahydrobiopterin deficiency.
Research has shown that sepiapterin can improve endothelial dysfunction and induce angiogenesis, making it a subject of interest in cardiovascular studies. Additionally, it has demonstrated inhibitory effects on the proliferation and migration of ovarian cancer cells through the down-regulation of p70 S6K-dependent VEGFR-2 expression. This suggests its potential as an anti-cancer agent.
Clinical trials and studies have explored sepiapterin’s efficacy in managing neurological disorders and circulatory diseases. For instance, it has been studied for its ability to prevent endothelial dysfunction and oxidative stress in diabetic mice, indicating its potential in treating complications associated with diabetes.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | L-Sepiapterin |
|---|---|
| IUPAC Name | 2-amino-6-[(2S)-2-hydroxypropanoyl]-7, 8-dihydro-3H-pteridin-4-one |
| CAS | 17094-01-8 |
| Molecular Weight | 237.22 |
| Molecular Formula | C9H11N5O3 |
| SMILES | C[C@@H](C(=O)C1=NC2=C(NC1)N=C(NC2=O)N)O |