Tranylcypromine, marketed under the brand name Parnate among others, is a potent monoamine oxidase inhibitor (MAOI) used primarily in the treatment of major depressive disorder, particularly in cases where patients have not responded to other antidepressants such as SSRIs or TCAs. This medication is also effective in managing atypical depression, obsessive-compulsive disorder, and panic disorder. Tranylcypromine acts by irreversibly inhibiting both MAO-A and MAO-B enzymes, leading to increased levels of neurotransmitters like serotonin, norepinephrine, and dopamine, which play crucial roles in mood regulation.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Tranylcypromine hemisulfate, TRANS-2-PHENYLCYCLOPROPYLAMINE HEMISULFATE SALT, Tranylcypromine sulphate |
|---|---|
| IUPAC Name | (1R, 2S)-2-phenylcyclopropan-1-amine;sulfuric acid |
| CAS | 13492-01-8 |
| Molecular Weight | 364.5 |
| Molecular Formula | C18H24N2O4S |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=CC=C2.C1[C@H]([C@@H]1N)C2=CC=CC=C2.OS(=O)(=O)O |