Vasopressin, also known as antidiuretic hormone (ADH) or arginine vasopressin (AVP), is a naturally occurring hormone synthesized in the hypothalamus and released from the posterior pituitary gland. It plays a crucial role in regulating the body’s water balance by controlling the reabsorption of water in the kidneys, thus influencing urine concentration and volume. Additionally, vasopressin acts as a vasoconstrictor, increasing peripheral vascular resistance and raising blood pressure.
Recent research has explored the potential of vasopressin and its analogues in treating SARS-CoV-2 infection, with studies suggesting that these hormones may influence the immune response and endothelial function during the disease. Additionally, vasopressin analogues are being investigated for their anti-cancer properties, particularly in reducing tumor-induced angiogenesis and metastatic spread.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | VASOTOCIN, [Arg8]-vasotocin |
|---|---|
| IUPAC Name | 1-[19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-butan-2-yl-16-[(4-hydroxyphenyl)methyl]-6, 9, 12, 15, 18-pentaoxo-1, 2-dithia-5, 8, 11, 14, 17-pentazacycloicosane-4-carbonyl]-N-[1-[(2-amino-2-oxoethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| CAS | 9034-50-8 |
| Molecular Weight | 1050.2 |
| Molecular Formula | C43H67N15O12S2 |
| SMILES | CCC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CSSCC(C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O)N)C(=O)N3CCCC3C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)N)CC(=O)N)CCC(=O)N |