Nicotinamide adenine dinucleotide (NAD+) is a vital coenzyme found in all living cells, playing a crucial role in metabolism. It consists of two nucleotides joined through their phosphate groups, with one containing adenine and the other nicotinamide. NAD+ exists in two forms: an oxidized form (NAD+) and a reduced form (NADH). NAD+ is a key player in redox reactions, acting as an electron carrier by accepting electrons to become NADH, which can then donate electrons to other molecules.
In cellular metabolism, NAD+ is involved in various processes, including energy production, DNA repair, and gene expression regulation. It serves as a substrate for enzymes like poly(ADP-ribose) polymerases (PARPs) and sirtuins, which are involved in DNA repair and epigenetic modifications, respectively. NAD+ is also a precursor for cyclic ADP-ribose, a secondary messenger in calcium signaling.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | NAD+, beta-NAD, nadine |
|---|---|
| IUPAC Name | [[(2R, 3S, 4R, 5R)-5-(6-aminopurin-9-yl)-3, 4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R, 3S, 4R, 5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3, 4-dihydroxyoxolan-2-yl]methyl phosphate |
| CAS | 53-84-9 |
| Molecular Weight | 663.4 |
| Molecular Formula | C21H27N7O14P2 |
| SMILES | C1=CC(=C[N+](=C1)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)([O-])OP(=O)(O)OC[C@@H]3[C@H]([C@H]([C@@H](O3)N4C=NC5=C(N=CN=C54)N)O)O)O)O)C(=O)N |


