4-Flmodafinil is a derivative of Modafinil
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| IUPAC Name | 2-[(4-fluorophenyl)-phenylmethyl]sulfinylacetamide |
|---|---|
| CAS | 90280-14-1 |
| Molecular Weight | 291.3 |
| Molecular Formula | C15H14FNO2S |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)F)S(=O)CC(=O)N |