Zatolmilast (BPN14770) is a selective phosphodiesterase 4D (PDE4D) allosteric inhibitor. This compound has demonstrated cognitive benefits in preclinical studies, including improved novel object recognition in mice.
Zatolmilast increases brain cAMP levels, enhances CREB phosphorylation, and boosts the production of brain-derived neurotrophic factor (BDNF) in the hippocampus. In a phase 2 clinical trial, BPN14770 was well-tolerated in adult males with Fragile X Syndrome (FXS) and showed significant cognitive improvements in language and daily functioning.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Zatolmilast |
|---|---|
| IUPAC Name | 2-[4-[[2-(3-chlorophenyl)-6-(trifluoromethyl)pyridin-4-yl]methyl]phenyl]acetic acid |
| CAS | 1606974-33-7 |
| Molecular Weight | 405.8 |
| Molecular Formula | C21H15ClF3NO2 |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=CC(=C2)CC3=CC=C(C=C3)CC(=O)O)C(F)(F)F |