Cinfenine is an experimental drug described as an antidepressant and coronary vasodilator that was never marketed. It was first documented in the literature in 1970.
Structurally, it is similar to modafinil derivatives and atypical dopamine reuptake inhibitors like JJC8-016, as well as antihistamines and anticholinergics such as diphenhydramine and its derivatives.
Cinfenine has been studied for its potential as a dopamine reuptake inhibitor, with notable analogues synthesized for further research.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Cinfeninum |
|---|---|
| IUPAC Name | (E)-N-(2-benzhydryloxyethyl)-N-methyl-3-phenylprop-2-en-1-amine |
| CAS | 54141-87-6 |
| Molecular Weight | 357.5 |
| Molecular Formula | C25H27NO |
| SMILES | CN(CCOC(C1=CC=CC=C1)C2=CC=CC=C2)C/C=C/C3=CC=CC=C3 |