Fenozolone is a psychostimulant developed by Laboratoires Dausse in the 1960s. It is chemically related to pemoline and functions as a centrally acting sympathomimetic.
It has been studied for its potential effects on the central nervous system, particularly in relation to its psychostimulant activity. Its mechanism of action, pharmacokinetics, and detailed clinical data remain largely unspecified.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Ordinator, Fenozolonum, Fenozolona |
|---|---|
| IUPAC Name | 2-ethylimino-5-phenyl-1, 3-oxazolidin-4-one |
| CAS | 15302-16-6 |
| Molecular Weight | 204.22 |
| Molecular Formula | C11H12N2O2 |
| SMILES | CCN=C1NC(=O)C(O1)C2=CC=CC=C2 |