Fisetin is a natural flavonol found in various fruits and vegetables, such as strawberries, apples, persimmons, onions, and cucumbers. It serves as a yellow/ochre coloring agent in plants and has been studied for its biological activities, including antioxidant, anticancer, and neuroprotective effects.
Fisetin is a member of the flavonoid group of polyphenols and was first described chemically by Austrian chemist Josef Herzig in 1891. It has been shown to inhibit pathways such as PI3K/AKT/mTOR, induce apoptosis, and act as a senolytic agent, reducing senescence markers and extending lifespan in animal models.
Fisetin is also a topoisomerase inhibitor and has anti-inflammatory properties, making it a promising compound for further research in aging and age-related diseases.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | 5-Desoxyquercetin |
|---|---|
| IUPAC Name | 2-(3, 4-dihydroxyphenyl)-3, 7-dihydroxychromen-4-one |
| CAS | 528-48-3 |
| Molecular Weight | 286.24 |
| Molecular Formula | C15H10O6 |
| SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O |