Fluralaner is a systemic insecticide and acaricide. It works by inhibiting γ-aminobutyric acid (GABA)-gated chloride channels and L-glutamate-gated chloride channels, making it highly effective against fleas and ticks in dogs and cats.
Research is ongoing to determine fluralaner’s potential in reducing the incidence of mosquito-borne diseases and controlling bed bugs. Studies have shown that fluralaner can significantly reduce the survival and fecundity of mosquitoes that feed on treated animals, making it a promising candidate for drug-based vector control strategies.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Bravecto, (+/-)-Fluralaner, Fluralaner, (+/-)- |
|---|---|
| IUPAC Name | 4-[5-(3, 5-dichlorophenyl)-5-(trifluoromethyl)-4H-1, 2-oxazol-3-yl]-2-methyl-N-[2-oxo-2-(2, 2, 2-trifluoroethylamino)ethyl]benzamide |
| CAS | 864731-61-3 |
| Molecular Weight | 556.3 |
| Molecular Formula | C22H17Cl2F6N3O3 |
| SMILES | CC1=C(C=CC(=C1)C2=NOC(C2)(C3=CC(=CC(=C3)Cl)Cl)C(F)(F)F)C(=O)NCC(=O)NCC(F)(F)F |