Guanfacine is molecule used for attention deficit hyperactivity disorder (ADHD) and high blood pressure. It is an alpha-2A adrenergic receptor agonist, which reduces sympathetic nervous system activity, leading to decreased blood pressure and improved focus and impulse control in ADHD.
It is metabolized by CYP3A4 and has a half-life of 17 hours. Guanfacine is considered non-addictive and is often used as an adjunct to stimulant medications for ADHD.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | guanfacine hydrochloride, GUANFACINE HCL, Tenex, Intuniv |
|---|---|
| IUPAC Name | N-(diaminomethylidene)-2-(2, 6-dichlorophenyl)acetamide;hydrochloride |
| CAS | 29110-48-3 |
| Molecular Weight | 282.5 |
| Molecular Formula | C9H10Cl3N3O |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)N=C(N)N)Cl.Cl |