Magnesium L-threonate, also known as MgT, is a specialized form of magnesium that has garnered attention for its potential cognitive benefits. This compound is a magnesium salt of L-threonic acid, a metabolite of vitamin C. Unlike other magnesium forms, magnesium L-threonate is noted for its ability to effectively cross the blood-brain barrier, making it a promising candidate for enhancing brain magnesium levels. This unique characteristic has led to its investigation in the context of cognitive function and neurological health.
Research suggests that magnesium L-threonate may support memory and cognitive performance by modulating synaptic plasticity and promoting synaptic density in the brain. These effects are attributed to the increased bioavailability of magnesium in the central nervous system when administered as magnesium L-threonate. Additionally, this compound is being studied for its potential role in mitigating symptoms associated with age-related cognitive decline and neurodegenerative conditions.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | L-Threonic acid magnesium salt, Magnesium L-threonate anhydrous |
|---|---|
| IUPAC Name | magnesium;(2R, 3S)-2, 3, 4-trihydroxybutanoate |
| CAS | 778571-57-6 |
| Molecular Weight | 294.5 |
| Molecular Formula | C8H14MgO10 |
| SMILES | C([C@@H]([C@H](C(=O)[O-])O)O)O.C([C@@H]([C@H](C(=O)[O-])O)O)O.[Mg+2] |