Medroxyprogesterone is a synthetic progestin that is structurally similar to naturally occurring progesterone. It is primarily used for contraception, hormone replacement therapy, and managing abnormal uterine bleeding. Medroxyprogesterone binds to progesterone receptors in the hypothalamus, female reproductive tract, and pituitary, inhibiting the secretion of gonadotropin-releasing hormone (GnRH) and thereby preventing follicular maturation and ovulation. It also changes the endometrium to a secretory state, making implantation difficult, and increases cervical mucus viscosity, impairing sperm migration.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Medroxyprogesteron, Medroxiprogesteronum, Medroxiprogesterona |
|---|---|
| IUPAC Name | (6S, 8R, 9S, 10R, 13S, 14S, 17R)-17-acetyl-17-hydroxy-6, 10, 13-trimethyl-2, 6, 7, 8, 9, 11, 12, 14, 15, 16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| CAS | 520-85-4 |
| Molecular Weight | 344.5 |
| Molecular Formula | C22H32O3 |
| SMILES | C[C@H]1C[C@@H]2[C@H](CC[C@]3([C@H]2CC[C@@]3(C(=O)C)O)C)[C@@]4(C1=CC(=O)CC4)C |