Myricetin is a naturally occurring flavonoid found in various fruits, vegetables, nuts, and beverages like tea and red wine. Myricetin is known for its strong antioxidant properties, which help protect against oxidative stress by scavenging reactive oxygen species (ROS) and chelating intracellular transition metal ions. This compound enhances the effects of other antioxidants and induces enzymes like glutathione S-transferase (GST), further protecting cells from free-radical damage.
Myricetin exhibits a wide range of potential health benefits. It acts as an anticarcinogen by reducing the risk of skin tumorigenicity caused by carcinogens like benzo(a)pyrene, inhibiting genetic mutations, and preventing the binding of carcinogens to DNA and proteins. Additionally, myricetin demonstrates antiviral activity by inhibiting the reverse transcriptase of viruses such as the human immunodeficiency virus (HIV). Its antithrombotic properties may prevent oxidative stress-induced platelet activation and aggregation, while its antidiabetic effects include increasing glucose uptake in cells and enhancing insulin sensitivity.
The compound also shows anti-inflammatory characteristics by inhibiting the production of cytokines and interfering with inflammatory signal pathways. Myricetin’s ability to inhibit platelet aggregation and act as a vasodilator further contributes to its potential cardiovascular benefits. Furthermore, it has been shown to protect neurons against oxidative stressors, suggesting neuroprotective properties.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Myricetol |
|---|---|
| IUPAC Name | 3, 5, 7-trihydroxy-2-(3, 4, 5-trihydroxyphenyl)chromen-4-one |
| CAS | 529-44-2 |
| Molecular Weight | 318.23 |
| Molecular Formula | C15H10O8 |
| SMILES | C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O |