Nicoracetam is a molecule from the racetam class.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Nicoracetam [INN], UNII-8U10GC2V6Y |
|---|---|
| IUPAC Name | 1-(6-methoxypyridine-3-carbonyl)pyrrolidin-2-one |
| CAS | 128326-80-7 |
| Molecular Weight | 220.22 |
| Molecular Formula | C11H12N2O3 |
| SMILES | COC1=NC=C(C=C1)C(=O)N2CCCC2=O |