Baclofen is a medication primarily used to treat muscle spasticity caused by conditions such as spinal cord injuries, multiple sclerosis, and cerebral palsy. It is a derivative of gamma-aminobutyric acid (GABA) and acts as a selective agonist for GABA-B receptors, which helps reduce muscle stiffness and spasms.
Baclofen is also used off-label for conditions like alcohol use disorder and opioid withdrawal.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | baclofen, Lioresal, 4-Amino-3-(4-chlorophenyl)butanoic acid Baclon |
|---|---|
| IUPAC Name | 4-amino-3-(4-chlorophenyl)butanoic acid |
| CAS | 1134-47-0 |
| Molecular Weight | 213.66 |
| Molecular Formula | C10H12ClNO2 |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)CN)Cl |