Rigin, also known as Tetrapeptide-7 is a bioactive peptide renowned for its anti-wrinkle properties and is widely used in cosmetic formulations. This oligopeptide is composed of four amino acids: glycine, glutamine, proline, and arginine.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Rigin, Tetrapeptide-7, Gly-gln-pro-arg, Glycyl-L-glutaminyl-L-prolyl-L-arginine |
|---|---|
| IUPAC Name | (2S)-2-[[(2S)-1-[(2S)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| CAS | 77727-17-4 |
| Molecular Weight | 456.5 |
| Molecular Formula | C18H32N8O6 |
| SMILES | C1C[C@H](N(C1)C(=O)[C@H](CCC(=O)N)NC(=O)CN)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |