Tianeptine is an atypical tricyclic antidepressant. Unlike traditional tricyclic antidepressants, tianeptine enhances serotonin reuptake rather than inhibiting it, which contributes to its unique pharmacological profile. It also acts as a full agonist at the mu-opioid receptor, producing effects similar to opioids, including euphoria and potential for abuse.
The drug is known for its efficacy in reducing depressive symptoms and alleviating anxiety, particularly in panic disorders. Tianeptine exhibits neuroprotective properties and has been shown to improve cognitive function in patients with depression. Its mechanism of action involves modulating glutamate and glutamatergic systems, which is thought to contribute to its antidepressant effects.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Stablon |
|---|---|
| IUPAC Name | 7-[(3-chloro-6-methyl-5, 5-dioxo-11H-benzo[c][2, 1]benzothiazepin-11-yl)amino]heptanoic acid |
| CAS | 66981-73-5 |
| Molecular Weight | 437 |
| Molecular Formula | C21H25ClN2O4S |
| SMILES | CN1C2=CC=CC=C2C(C3=C(S1(=O)=O)C=C(C=C3)Cl)NCCCCCCC(=O)O |