Vilon, also known as Lysylglutamic acid or Lysylglutamate, is a dipeptide composed of the amino acids lysine and glutamic acid. This compound is classified as a bio-modulator and is being researched for its potential in various biological processes, particularly in the realm of immune cell regulation, proliferation, and differentiation. Vilon’s chemical structure and properties suggest it may interact with genetic material, potentially influencing gene expression.
Research indicates that Vilon could play a role in chromatin remodeling, specifically by inducing deheterochromatinization, which may reactivate ribosomal genes and release genes that were previously repressed due to the condensation of euchromatic regions. This process could lead to the activation of previously inactive genes, thereby influencing cellular functions. Importantly, Vilon does not seem to affect pericentromeric structural heterochromatin, suggesting its actions are selective towards facultative heterochromatin.
In studies involving thymocytes, Vilon has been shown to stimulate proliferative activity, promote the recovery of critical tissues exposed to γ-irradiation, and increase the presence of proliferating cell nuclear antigen (PCNA)-positive nuclei. This indicates that Vilon may support cellular proliferation and regeneration, particularly in the thymus and intestinal epithelium. Additionally, Vilon has been observed to normalize lymphocyte numbers and increase granulocyte counts in experimental models, further supporting its role in immune system function.
Vilon’s potential in cancer research is also being explored. Studies have suggested that it may reduce the incidence of certain tumor cells, such as pulmonary adenoma and mammary adenocarcinoma cells, possibly due to its immunomodulatory properties. By supporting immune system function and potentially inhibiting inflammatory processes, Vilon could play a role in preventing the initiation of carcinogenesis and reducing tumor cell occurrence.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | lysylglutamic acid, Lys-Glu, H-LYS-GLU-OH |
|---|---|
| IUPAC Name | (2S)-2-[[(2S)-2, 6-diaminohexanoyl]amino]pentanedioic acid |
| CAS | 45234-02-4 |
| Molecular Weight | 275.3 |
| Molecular Formula | C11H21N3O5 |
| SMILES | C(CCN)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)N |