Y134 is a selective and orally active estrogen receptor (ER) modulator (SERM) that exhibits potent antagonist activity at both ERα and ERβ. With a 121.1-fold selectivity for ERα over ERβ, Y134 effectively inhibits estrogen-stimulated proliferation of ER-positive human breast cancer cells.
This compound demonstrates significant potential in the field of breast cancer research and treatment, particularly due to its high affinity for ERα, which is a key target in many breast cancer therapies.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Y134 compound, Y 134 |
|---|---|
| IUPAC Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methanone |
| CAS | 849662-80-2 |
| Molecular Weight | 472.6 |
| Molecular Formula | C28H28N2O3S |
| SMILES | CC(C)N1CCN(CC1)C2=CC=C(C=C2)C(=O)C3=C(SC4=C3C=CC(=C4)O)C5=CC=C(C=C5)O |