Feprosidnine, sold under the brand name Sydnophen, is a stimulant drug developed in the USSR in the 1970s. It is structurally related to mesocarb but has unique antidepressant activity, making it useful for treating conditions such as apathetic and asthenic depressions, fatigue, narcolepsy, and similar disorders.
Feprosidnine exhibits multiple mechanisms of action, including reversible monoamine oxidase inhibition, cholinergic, adrenergic, opioid, and nitric oxide-donating effects, contributing to its pharmacological profile. It is a mesoionic sydnone imine and was withdrawn from production earlier than mesocarb.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| IUPAC Name | 3-(1-phenylpropan-2-yl)-1-oxa-3-azonia-2-azanidacyclopent-3-en-5-imine |
|---|---|
| CAS | 22293-47-6 |
| Molecular Weight | 203.24 |
| Molecular Formula | C11H13N3O |
| SMILES | CC(CC1=CC=CC=C1)[N+]2=CC(=N)O[N-]2 |