Tyrosine is a nonessential amino acid synthesized by the body from phenylalanine, playing a crucial role in the production of key neurotransmitters like epinephrine, norepinephrine, and dopamine.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | tyrosine, (S)-Tyrosine, p-Tyrosine |
|---|---|
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
| CAS | 60-18-4 |
| Molecular Weight | 181.19 |
| Molecular Formula | C9H11NO3 |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)O |