Roxadustat is an innovative molecule designed to combat anemia associated with chronic kidney disease (CKD). As a hypoxia-inducible factor (HIF) prolyl-hydroxylase inhibitor, Roxadustat works by increasing endogenous erythropoietin production, enhancing iron regulation, and reducing hepcidin levels, thereby stimulating the production of hemoglobin and red blood cells. This oral medication has demonstrated efficacy in clinical trials, showing significant improvements in hemoglobin levels and iron homeostasis in CKD patients.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | FG-4592, FG4592 |
|---|---|
| IUPAC Name | 2-[(4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carbonyl)amino]acetic acid |
| CAS | 808118-40-3 |
| Molecular Weight | 352.3 |
| Molecular Formula | C19H16N2O5 |
| SMILES | CC1=C2C=C(C=CC2=C(C(=N1)C(=O)NCC(=O)O)O)OC3=CC=CC=C3 |