Agmatine is a chemical compound derived from the amino acid L-arginine through decarboxylation. It acts as a neurotransmitter and neuromodulator, influencing multiple molecular targets such as neurotransmitter systems, ion channels, and nitric oxide synthesis.
Agmatine is an endogenous agonist at imidazoline receptors and a competitive inhibitor of nitric oxide synthase (NOS). It has been studied for its potential roles in neuroprotection, pain modulation, and mood regulation.
Agmatine is also known to interact with NMDA receptors, calcium channels, and certain serotonin receptors, making it a compound of interest in neuroscience and pharmacology research.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Agmatine sulfate, 1-(4-Aminobutyl)guanidine sulfate, 1-Amino-4-guanidinobutane sulfate salt, Guanidine, N-(4-aminobutyl)-, sulfate (1:1) |
|---|---|
| IUPAC Name | 2-(4-aminobutyl)guanidine;sulfuric acid |
| CAS | 2482-00-0 |
| Molecular Weight | 228.27 |
| Molecular Formula | C5H16N4O4S |
| SMILES | C(CCN=C(N)N)CN.OS(=O)(=O)O |