Imuracetam is a nootropic drug belonging to the racetam group, known for its cognitive-enhancing properties. It was developed in the 1970s but never reached the market.
The above information is displayed for information purpose only, and has not been reviewed by EON nor does EON attests or validates the accuracy nor does it constitutes a recommendation or validation.
| Other Names | Imuracetam [INN], 972FNV35ZM |
|---|---|
| IUPAC Name | 1, 3-bis[(2-oxopyrrolidin-1-yl)methyl]urea |
| CAS | 67542-41-0 |
| Molecular Weight | 254.29 |
| Molecular Formula | C11H18N4O3 |
| SMILES | C1CC(=O)N(C1)CNC(=O)NCN2CCCC2=O |